C8H4F10O2 — CID 20802258
(7E)-3,3,4,4,8,9,9-heptafluoro-6-(trifluoromethyl)-2,6-dihydro-1,5-dioxonine (PubChem CID 20802258) has the molecular formula C8H4F10O2 and a molecular weight of 322.10 g/mol. Its IUPAC name is (7E)-3,3,4,4,8,9,9-heptafluoro-6-(trifluoromethyl)-2,6-dihydro-1,5-dioxonine.
| Compound Name | (7E)-3,3,4,4,8,9,9-heptafluoro-6-(trifluoromethyl)-2,6-dihydro-1,5-dioxonine |
|---|---|
| PubChem CID | 20802258 |
| Molecular Formula | C8H4F10O2 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | (7E)-3,3,4,4,8,9,9-heptafluoro-6-(trifluoromethyl)-2,6-dihydro-1,5-dioxonine |
| SMILES | F/C1=C/C(C(F)(F)F)OC(F)(F)C(F)(F)COC1(F)F |
| InChI | InChI=1S/C8H4F10O2/c9-3-1-4(6(12,13)14)20-8(17,18)5(10,11)2-19-7(3,15)16/h1,4H,2H2/b3-1+ |
| InChIKey | HAPOBAKSSSMMLS-HNQUOIGGSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|