C10H6F12O — CID 141454665
1,1,1,5,5,5-hexafluoro-4-(1,1,1,5,5,5-hexafluoropent-3-en-2-yloxy)pent-2-ene (PubChem CID 141454665) has the molecular formula C10H6F12O and a molecular weight of 370.13 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-(1,1,1,5,5,5-hexafluoropent-3-en-2-yloxy)pent-2-ene.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-(1,1,1,5,5,5-hexafluoropent-3-en-2-yloxy)pent-2-ene |
|---|---|
| PubChem CID | 141454665 |
| Molecular Formula | C10H6F12O |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-(1,1,1,5,5,5-hexafluoropent-3-en-2-yloxy)pent-2-ene |
| SMILES | FC(F)(F)C=CC(OC(C=CC(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F12O/c11-7(12,13)3-1-5(9(17,18)19)23-6(10(20,21)22)2-4-8(14,15)16/h1-6H |
| InChIKey | UCRFWONZWVHHFB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|