C21H21N7O4S — CID 20805716
2-[4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]sulfonylguanidine (PubChem CID 20805716) has the molecular formula C21H21N7O4S and a molecular weight of 467.51 g/mol. Its IUPAC name is 2-[4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 20805716 |
| Molecular Formula | C21H21N7O4S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]sulfonylguanidine |
| SMILES | COc1ccc(-c2cc3nccn3c(Nc3ccc(S(=O)(=O)N=C(N)N)cc3)n2)cc1OC |
| InChI | InChI=1S/C21H21N7O4S/c1-31-17-8-3-13(11-18(17)32-2)16-12-19-24-9-10-28(19)21(26-16)25-14-4-6-15(7-5-14)33(29,30)27-20(22)23/h3-12H,1-2H3,(H,25,26)(H4,22,23,27) |
| InChIKey | LQXDVVLVUYWGNX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|