C28H29N5O5 — CID 20806187
tert-butyl (E)-3-[3-carbamoyl-4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]prop-2-enoate (PubChem CID 20806187) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is tert-butyl (E)-3-[3-carbamoyl-4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[3-carbamoyl-4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 20806187 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | tert-butyl (E)-3-[3-carbamoyl-4-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]phenyl]prop-2-enoate |
| SMILES | COc1ccc(-c2cc3nccn3c(Nc3ccc(/C=C/C(=O)OC(C)(C)C)cc3C(N)=O)n2)cc1OC |
| InChI | InChI=1S/C28H29N5O5/c1-28(2,3)38-25(34)11-7-17-6-9-20(19(14-17)26(29)35)31-27-32-21(16-24-30-12-13-33(24)27)18-8-10-22(36-4)23(15-18)37-5/h6-16H,1-5H3,(H2,29,35)(H,31,32)/b11-7+ |
| InChIKey | QZLPOHWPOASSTP-YRNVUSSQSA-N |
| XLogP | 4.61 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|