C21H20N6O2 — CID 20805837
3-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]benzenecarboximidamide (PubChem CID 20805837) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]benzenecarboximidamide.
| Compound Name | 3-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 20805837 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Nc2nc(-c3ccc(OC)c(OC)c3)cc3nccn23)c1 |
| InChI | InChI=1S/C21H20N6O2/c1-28-17-7-6-13(11-18(17)29-2)16-12-19-24-8-9-27(19)21(26-16)25-15-5-3-4-14(10-15)20(22)23/h3-12H,1-2H3,(H3,22,23)(H,25,26) |
| InChIKey | NPPLOFBMSOJRNL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|