C38H42AgN4O2-2 — CID 20806997
bis(1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazol-2-ide);silver (PubChem CID 20806997) has the molecular formula C38H42AgN4O2-2 and a molecular weight of 694.65 g/mol. Its IUPAC name is bis(1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazol-2-ide);silver.
| Compound Name | bis(1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazol-2-ide);silver |
|---|---|
| PubChem CID | 20806997 |
| Molecular Formula | C38H42AgN4O2-2 |
| Molecular Weight | 694.65 g/mol |
| Exact Mass | 693.24 |
| IUPAC Name | bis(1-benzyl-4,5-dimethyl-3-phenylmethoxy-2H-imidazol-2-ide);silver |
| SMILES | CC1=C(C)N(OCc2ccccc2)[CH-]N1Cc1ccccc1.CC1=C(C)N(OCc2ccccc2)[CH-]N1Cc1ccccc1.[Ag] |
| InChI | InChI=1S/2C19H21N2O.Ag/c2*1-16-17(2)21(22-14-19-11-7-4-8-12-19)15-20(16)13-18-9-5-3-6-10-18;/h2*3-12,15H,13-14H2,1-2H3;/q2*-1; |
| InChIKey | LONGBNDCXLWWHF-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|