C30H29NO6S — CID 2081142
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate (PubChem CID 2081142) has the molecular formula C30H29NO6S and a molecular weight of 531.63 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 2081142 |
| Molecular Formula | C30H29NO6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3cccc(S(=O)(=O)N4c5ccccc5C[C@H]4C)c3)c2cc1C(C)C |
| InChI | InChI=1S/C30H29NO6S/c1-18(2)25-16-26-23(15-29(32)37-28(26)12-19(25)3)17-36-30(33)22-9-7-10-24(14-22)38(34,35)31-20(4)13-21-8-5-6-11-27(21)31/h5-12,14-16,18,20H,13,17H2,1-4H3/t20-/m1/s1 |
| InChIKey | HKZZIBPXWYUPOK-HXUWFJFHSA-N |
| XLogP | 5.72 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|