C31H33NO6S — CID 2394561
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[butyl(phenyl)sulfamoyl]benzoate (PubChem CID 2394561) has the molecular formula C31H33NO6S and a molecular weight of 547.67 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[butyl(phenyl)sulfamoyl]benzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[butyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2394561 |
| Molecular Formula | C31H33NO6S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-[butyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCCCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OCc2cc(=O)oc3cc(C)c(C(C)C)cc23)c1 |
| InChI | InChI=1S/C31H33NO6S/c1-5-6-15-32(25-12-8-7-9-13-25)39(35,36)26-14-10-11-23(17-26)31(34)37-20-24-18-30(33)38-29-16-22(4)27(21(2)3)19-28(24)29/h7-14,16-19,21H,5-6,15,20H2,1-4H3 |
| InChIKey | RDDOCXFWZHENBS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|