C15H11F15 — CID 20813473
1,2,3,4,5-pentakis(2,2,2-trifluoroethyl)cyclopenta-1,3-diene (PubChem CID 20813473) has the molecular formula C15H11F15 and a molecular weight of 476.22 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis(2,2,2-trifluoroethyl)cyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5-pentakis(2,2,2-trifluoroethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 20813473 |
| Molecular Formula | C15H11F15 |
| Molecular Weight | 476.22 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1,2,3,4,5-pentakis(2,2,2-trifluoroethyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)CC1=C(CC(F)(F)F)C(CC(F)(F)F)C(CC(F)(F)F)=C1CC(F)(F)F |
| InChI | InChI=1S/C15H11F15/c16-11(17,18)1-6-7(2-12(19,20)21)9(4-14(25,26)27)10(5-15(28,29)30)8(6)3-13(22,23)24/h6H,1-5H2 |
| InChIKey | SMQLCNXJSONTIL-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.22 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |