About [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane
[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane (PubChem CID 10655625) has the molecular formula C8H9F5
and a molecular weight of 200.15 g/mol. Its IUPAC name is [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane.
Analyze [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane?
The IUPAC name of [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane (CID 10655625) is [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane.
What is the SMILES notation for [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane?
The canonical SMILES for [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane is F/C(=C(\F)C(F)(F)F)C1CCCC1.
What is the InChIKey of [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane?
The InChIKey is MLGRTGHAYBPMLC-SREVYHEPSA-N. The full InChI is InChI=1S/C8H9F5/c9-6(5-3-1-2-4-5)7(10)8(11,12)13/h5H,1-4H2/b7-6-.
What are the key properties of [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane?
[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane has a molecular weight of 200.15 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]cyclopentane is sourced from PubChem (CID 10655625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).