C23H22N2O6 — CID 20814234
methyl 3-[(Z)-3-ethoxy-1-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-3-oxoprop-1-enyl]benzoate (PubChem CID 20814234) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 3-[(Z)-3-ethoxy-1-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 3-[(Z)-3-ethoxy-1-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 20814234 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | methyl 3-[(Z)-3-ethoxy-1-[3-methoxy-4-(1,3-oxazol-5-yl)anilino]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCOC(=O)/C=C(\Nc1ccc(-c2cnco2)c(OC)c1)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H22N2O6/c1-4-30-22(26)12-19(15-6-5-7-16(10-15)23(27)29-3)25-17-8-9-18(20(11-17)28-2)21-13-24-14-31-21/h5-14,25H,4H2,1-3H3/b19-12- |
| InChIKey | BMSVVXNORCKONO-UNOMPAQXSA-N |
| XLogP | 4.15 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|