C9H16N2O8S — CID 20821778
2-[(3-acetamido-2-hydroxypropanoyl)amino]-4-sulfobutanoic acid (PubChem CID 20821778) has the molecular formula C9H16N2O8S and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-[(3-acetamido-2-hydroxypropanoyl)amino]-4-sulfobutanoic acid.
| Compound Name | 2-[(3-acetamido-2-hydroxypropanoyl)amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 20821778 |
| Molecular Formula | C9H16N2O8S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-[(3-acetamido-2-hydroxypropanoyl)amino]-4-sulfobutanoic acid |
| SMILES | CC(=O)NCC(O)C(=O)NC(CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O8S/c1-5(12)10-4-7(13)8(14)11-6(9(15)16)2-3-20(17,18)19/h6-7,13H,2-4H2,1H3,(H,10,12)(H,11,14)(H,15,16)(H,17,18,19) |
| InChIKey | TYNYKGMRAUFCPR-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|