About 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium
4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium (PubChem CID 20822489) has the molecular formula C17H22ClN3O3Re
and a molecular weight of 538.04 g/mol. Its IUPAC name is 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium.
Molecular Properties
| Compound Name | 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium |
| PubChem CID | 20822489 |
| Molecular Formula | C17H22ClN3O3Re |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium |
| SMILES | C=O.C=O.C=O.CCCCCc1cnc(-c2ccccn2)nc1Cl.[Re] |
| InChI | InChI=1S/C14H16ClN3.3CH2O.Re/c1-2-3-4-7-11-10-17-14(18-13(11)15)12-8-5-6-9-16-12;3*1-2;/h5-6,8-10H,2-4,7H2,1H3;3*1H2; |
| InChIKey | GOCNFKDRUTXJHZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium?
The IUPAC name of 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium (CID 20822489) is 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium.
What is the SMILES notation for 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium?
The canonical SMILES for 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium is C=O.C=O.C=O.CCCCCc1cnc(-c2ccccn2)nc1Cl.[Re].
What is the InChIKey of 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium?
The InChIKey is GOCNFKDRUTXJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3.3CH2O.Re/c1-2-3-4-7-11-10-17-14(18-13(11)15)12-8-5-6-9-16-12;3*1-2;/h5-6,8-10H,2-4,7H2,1H3;3*1H2;.
What are the key properties of 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium?
4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium has a molecular weight of 538.04 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-pentyl-2-pyridin-2-ylpyrimidine;formaldehyde;rhenium is sourced from PubChem (CID 20822489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).