C19H15F4N2O- — CID 20824785
N-butyl-5-fluoro-2-[4-isocyano-3-(trifluoromethyl)phenyl]benzenecarboximidate (PubChem CID 20824785) has the molecular formula C19H15F4N2O- and a molecular weight of 363.33 g/mol. Its IUPAC name is N-butyl-5-fluoro-2-[4-isocyano-3-(trifluoromethyl)phenyl]benzenecarboximidate.
| Compound Name | N-butyl-5-fluoro-2-[4-isocyano-3-(trifluoromethyl)phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 20824785 |
| Molecular Formula | C19H15F4N2O- |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-butyl-5-fluoro-2-[4-isocyano-3-(trifluoromethyl)phenyl]benzenecarboximidate |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(F)cc2/C([O-])=N/CCCC)cc1C(F)(F)F |
| InChI | InChI=1S/C19H16F4N2O/c1-3-4-9-25-18(26)15-11-13(20)6-7-14(15)12-5-8-17(24-2)16(10-12)19(21,22)23/h5-8,10-11H,3-4,9H2,1H3,(H,25,26)/p-1 |
| InChIKey | JSCCEVHNPRCLFT-UHFFFAOYSA-M |
| XLogP | 4.97 |
| TPSA | 39.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|