C20H34O6 — CID 20824920
7,11-dihydroxy-3,8,8,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 20824920) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is 7,11-dihydroxy-3,8,8,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 7,11-dihydroxy-3,8,8,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 20824920 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 7,11-dihydroxy-3,8,8,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1CC2OC2(C)CCCC(C)C(O)CC(=O)C(C)(C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C20H34O6/c1-12-7-6-8-20(5)17(26-20)9-13(2)25-18(24)11-16(23)19(3,4)15(22)10-14(12)21/h12-14,16-17,21,23H,6-11H2,1-5H3 |
| InChIKey | FKZDOXLHTHOKEE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|