C25H24N4O6 — CID 20831265
2-[(Z)-1-benzamido-2-(3,4,5-trimethoxyphenyl)ethenyl]-N-hydroxy-3H-benzimidazol-5-amine oxide (PubChem CID 20831265) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-[(Z)-1-benzamido-2-(3,4,5-trimethoxyphenyl)ethenyl]-N-hydroxy-3H-benzimidazol-5-amine oxide.
| Compound Name | 2-[(Z)-1-benzamido-2-(3,4,5-trimethoxyphenyl)ethenyl]-N-hydroxy-3H-benzimidazol-5-amine oxide |
|---|---|
| PubChem CID | 20831265 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-[(Z)-1-benzamido-2-(3,4,5-trimethoxyphenyl)ethenyl]-N-hydroxy-3H-benzimidazol-5-amine oxide |
| SMILES | COc1cc(/C=C(\NC(=O)c2ccccc2)c2nc3ccc([NH+]([O-])O)cc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O6/c1-33-21-12-15(13-22(34-2)23(21)35-3)11-20(28-25(30)16-7-5-4-6-8-16)24-26-18-10-9-17(29(31)32)14-19(18)27-24/h4-14,29,31H,1-3H3,(H,26,27)(H,28,30)/b20-11- |
| InChIKey | WLOAEQNLAFIFKU-JAIQZWGSSA-N |
| XLogP | 2.92 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|