C22H15ClN4O3 — CID 5387521
N-[(Z)-1-(6-chloro-1H-benzimidazol-2-yl)-2-(4-nitrophenyl)ethenyl]benzamide (PubChem CID 5387521) has the molecular formula C22H15ClN4O3 and a molecular weight of 418.84 g/mol. Its IUPAC name is N-[(Z)-1-(6-chloro-1H-benzimidazol-2-yl)-2-(4-nitrophenyl)ethenyl]benzamide.
| Compound Name | N-[(Z)-1-(6-chloro-1H-benzimidazol-2-yl)-2-(4-nitrophenyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 5387521 |
| Molecular Formula | C22H15ClN4O3 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[(Z)-1-(6-chloro-1H-benzimidazol-2-yl)-2-(4-nitrophenyl)ethenyl]benzamide |
| SMILES | O=C(N/C(=C\c1ccc([N+](=O)[O-])cc1)c1nc2ccc(Cl)cc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C22H15ClN4O3/c23-16-8-11-18-19(13-16)25-21(24-18)20(26-22(28)15-4-2-1-3-5-15)12-14-6-9-17(10-7-14)27(29)30/h1-13H,(H,24,25)(H,26,28)/b20-12- |
| InChIKey | BAIPJRVPJMGIOF-NDENLUEZSA-N |
| XLogP | 5.05 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|