C25H23N3O5S — CID 20832160
N-hydroxy-4-[(E)-[2-(4-methoxyphenyl)-4-oxo-3-[(2-phenylacetyl)amino]-1,3-thiazolidin-5-ylidene]methyl]benzeneamine oxide (PubChem CID 20832160) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-hydroxy-4-[(E)-[2-(4-methoxyphenyl)-4-oxo-3-[(2-phenylacetyl)amino]-1,3-thiazolidin-5-ylidene]methyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[(E)-[2-(4-methoxyphenyl)-4-oxo-3-[(2-phenylacetyl)amino]-1,3-thiazolidin-5-ylidene]methyl]benzeneamine oxide |
|---|---|
| PubChem CID | 20832160 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-hydroxy-4-[(E)-[2-(4-methoxyphenyl)-4-oxo-3-[(2-phenylacetyl)amino]-1,3-thiazolidin-5-ylidene]methyl]benzeneamine oxide |
| SMILES | COc1ccc(C2S/C(=C/c3ccc([NH+]([O-])O)cc3)C(=O)N2NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-33-21-13-9-19(10-14-21)25-27(26-23(29)16-17-5-3-2-4-6-17)24(30)22(34-25)15-18-7-11-20(12-8-18)28(31)32/h2-15,25,28,31H,16H2,1H3,(H,26,29)/b22-15+ |
| InChIKey | NRBABWXDRZUPGM-PXLXIMEGSA-N |
| XLogP | 2.99 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|