C25H21NO4S — CID 91098288
2-hydroxy-5-[(4-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidin-4-one (PubChem CID 91098288) has the molecular formula C25H21NO4S and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-hydroxy-5-[(4-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-hydroxy-5-[(4-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91098288 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-hydroxy-5-[(4-methoxyphenyl)methylidene]-3-[2-oxo-2-(4-phenylphenyl)ethyl]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2SC(O)N(CC(=O)c3ccc(-c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H21NO4S/c1-30-21-13-7-17(8-14-21)15-23-24(28)26(25(29)31-23)16-22(27)20-11-9-19(10-12-20)18-5-3-2-4-6-18/h2-15,25,29H,16H2,1H3 |
| InChIKey | GBETUKKULNQTLI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|