C25H22N2O4S — CID 92531239
N-[(2S,5E)-5-[(4-hydroxyphenyl)methylidene]-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-phenylacetamide (PubChem CID 92531239) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[(2S,5E)-5-[(4-hydroxyphenyl)methylidene]-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[(2S,5E)-5-[(4-hydroxyphenyl)methylidene]-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 92531239 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[(2S,5E)-5-[(4-hydroxyphenyl)methylidene]-2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-2-phenylacetamide |
| SMILES | COc1ccc([C@@H]2S/C(=C/c3ccc(O)cc3)C(=O)N2NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O4S/c1-31-21-13-9-19(10-14-21)25-27(26-23(29)16-17-5-3-2-4-6-17)24(30)22(32-25)15-18-7-11-20(28)12-8-18/h2-15,25,28H,16H2,1H3,(H,26,29)/b22-15+/t25-/m0/s1 |
| InChIKey | USNKAGHCIDPJNQ-DIXABZHVSA-N |
| XLogP | 4.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|