About 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide
4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide (PubChem CID 20833597) has the molecular formula C15H10Cl2N2O3
and a molecular weight of 337.16 g/mol. Its IUPAC name is 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide.
Molecular Properties
| Compound Name | 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide |
| PubChem CID | 20833597 |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide |
| SMILES | N#C/C(=C/c1cc(Cl)cc(Cl)c1O)c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C15H10Cl2N2O3/c16-12-6-10(15(20)14(17)7-12)5-11(8-18)9-1-3-13(4-2-9)19(21)22/h1-7,19-21H/b11-5- |
| InChIKey | LVHAQBLFZVKUEJ-WZUFQYTHSA-N |
| XLogP | 3.17 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide?
The IUPAC name of 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide (CID 20833597) is 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide.
What is the SMILES notation for 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide?
The canonical SMILES for 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide is N#C/C(=C/c1cc(Cl)cc(Cl)c1O)c1ccc([NH+]([O-])O)cc1.
What is the InChIKey of 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide?
The InChIKey is LVHAQBLFZVKUEJ-WZUFQYTHSA-N. The full InChI is InChI=1S/C15H10Cl2N2O3/c16-12-6-10(15(20)14(17)7-12)5-11(8-18)9-1-3-13(4-2-9)19(21)22/h1-7,19-21H/b11-5-.
What are the key properties of 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide?
4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide has a molecular weight of 337.16 g/mol, XLogP of 3.17, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-1-cyano-2-(3,5-dichloro-2-hydroxyphenyl)ethenyl]-N-hydroxybenzeneamine oxide is sourced from PubChem (CID 20833597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).