C30H27ClN4O6 — CID 20835114
3-[[(5E)-7-(4-chlorophenyl)-5-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]-7-oxoheptanoyl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 20835114) has the molecular formula C30H27ClN4O6 and a molecular weight of 575.02 g/mol. Its IUPAC name is 3-[[(5E)-7-(4-chlorophenyl)-5-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]-7-oxoheptanoyl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[[(5E)-7-(4-chlorophenyl)-5-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]-7-oxoheptanoyl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 20835114 |
| Molecular Formula | C30H27ClN4O6 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 3-[[(5E)-7-(4-chlorophenyl)-5-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]-7-oxoheptanoyl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(CCC/C(CC(=O)c1ccc(Cl)cc1)=N\NC(=O)c1cc2ccccc2cc1O)Nc1cccc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C30H27ClN4O6/c31-22-13-11-19(12-14-22)27(36)18-24(8-4-10-29(38)32-23-7-3-9-25(17-23)35(40)41)33-34-30(39)26-15-20-5-1-2-6-21(20)16-28(26)37/h1-3,5-7,9,11-17,35,37,40H,4,8,10,18H2,(H,32,38)(H,34,39)/b33-24+ |
| InChIKey | AGXJOJDCOGTUNE-IWBSIUBASA-N |
| XLogP | 4.77 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|