C19H19BrN2O3 — CID 5388120
(5Z)-7-(4-bromophenyl)-5-hydroxyimino-7-oxo-N-phenylheptanamide (PubChem CID 5388120) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is (5Z)-7-(4-bromophenyl)-5-hydroxyimino-7-oxo-N-phenylheptanamide.
| Compound Name | (5Z)-7-(4-bromophenyl)-5-hydroxyimino-7-oxo-N-phenylheptanamide |
|---|---|
| PubChem CID | 5388120 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | (5Z)-7-(4-bromophenyl)-5-hydroxyimino-7-oxo-N-phenylheptanamide |
| SMILES | O=C(CCC/C(CC(=O)c1ccc(Br)cc1)=N/O)Nc1ccccc1 |
| InChI | InChI=1S/C19H19BrN2O3/c20-15-11-9-14(10-12-15)18(23)13-17(22-25)7-4-8-19(24)21-16-5-2-1-3-6-16/h1-3,5-6,9-12,25H,4,7-8,13H2,(H,21,24)/b22-17- |
| InChIKey | NYHLULSTEBJGGS-XLNRJJMWSA-N |
| XLogP | 4.66 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|