C23H26ClN5O4 — CID 4577337
7-(4-chlorophenyl)-N-(3,4-dimethylphenyl)-5-[(2-hydrazinyl-2-oxoacetyl)hydrazinylidene]-7-oxoheptanamide (PubChem CID 4577337) has the molecular formula C23H26ClN5O4 and a molecular weight of 471.95 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-N-(3,4-dimethylphenyl)-5-[(2-hydrazinyl-2-oxoacetyl)hydrazinylidene]-7-oxoheptanamide.
| Compound Name | 7-(4-chlorophenyl)-N-(3,4-dimethylphenyl)-5-[(2-hydrazinyl-2-oxoacetyl)hydrazinylidene]-7-oxoheptanamide |
|---|---|
| PubChem CID | 4577337 |
| Molecular Formula | C23H26ClN5O4 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 7-(4-chlorophenyl)-N-(3,4-dimethylphenyl)-5-[(2-hydrazinyl-2-oxoacetyl)hydrazinylidene]-7-oxoheptanamide |
| SMILES | Cc1ccc(NC(=O)CCCC(CC(=O)c2ccc(Cl)cc2)=NNC(=O)C(=O)NN)cc1C |
| InChI | InChI=1S/C23H26ClN5O4/c1-14-6-11-18(12-15(14)2)26-21(31)5-3-4-19(28-29-23(33)22(32)27-25)13-20(30)16-7-9-17(24)10-8-16/h6-12H,3-5,13,25H2,1-2H3,(H,26,31)(H,27,32)(H,29,33) |
| InChIKey | ZATAJNGAFIIRPH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|