C13H9Cl3O4S — CID 20836215
2-hydroxy-3-[(2,3,4-trichlorophenyl)methyl]benzenesulfonic acid (PubChem CID 20836215) has the molecular formula C13H9Cl3O4S and a molecular weight of 367.64 g/mol. Its IUPAC name is 2-hydroxy-3-[(2,3,4-trichlorophenyl)methyl]benzenesulfonic acid.
| Compound Name | 2-hydroxy-3-[(2,3,4-trichlorophenyl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 20836215 |
| Molecular Formula | C13H9Cl3O4S |
| Molecular Weight | 367.64 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 2-hydroxy-3-[(2,3,4-trichlorophenyl)methyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(Cc2ccc(Cl)c(Cl)c2Cl)c1O |
| InChI | InChI=1S/C13H9Cl3O4S/c14-9-5-4-7(11(15)12(9)16)6-8-2-1-3-10(13(8)17)21(18,19)20/h1-5,17H,6H2,(H,18,19,20) |
| InChIKey | CZFXIMPMCADUDW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|