C13H8Cl3NaO4S — CID 23668191
sodium 3-hydroxy-2-[(2,3,4-trichlorophenyl)methyl]benzenesulfonate (PubChem CID 23668191) has the molecular formula C13H8Cl3NaO4S and a molecular weight of 389.62 g/mol. Its IUPAC name is sodium 3-hydroxy-2-[(2,3,4-trichlorophenyl)methyl]benzenesulfonate.
| Compound Name | sodium 3-hydroxy-2-[(2,3,4-trichlorophenyl)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 23668191 |
| Molecular Formula | C13H8Cl3NaO4S |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | sodium 3-hydroxy-2-[(2,3,4-trichlorophenyl)methyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(O)c1Cc1ccc(Cl)c(Cl)c1Cl.[Na+] |
| InChI | InChI=1S/C13H9Cl3O4S.Na/c14-9-5-4-7(12(15)13(9)16)6-8-10(17)2-1-3-11(8)21(18,19)20;/h1-5,17H,6H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | JXBYLDQMMLRTIB-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|