About sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite
sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite (PubChem CID 20837891) has the molecular formula C16H13N3NaO3S-
and a molecular weight of 350.36 g/mol. Its IUPAC name is sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite.
Molecular Properties
| Compound Name | sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite |
| PubChem CID | 20837891 |
| Molecular Formula | C16H13N3NaO3S- |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite |
| SMILES | Nc1ccc(/N=N/c2ccccc2)c2ccccc12.O=S([O-])[O-].[Na+] |
| InChI | InChI=1S/C16H13N3.Na.H2O3S/c17-15-10-11-16(14-9-5-4-8-13(14)15)19-18-12-6-2-1-3-7-12;;1-4(2)3/h1-11H,17H2;;(H2,1,2,3)/q;+1;/p-2/b19-18+;; |
| InChIKey | WHNKXIVKNVARCE-BUFQOAPZSA-L |
| XLogP | 0.84 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite?
The IUPAC name of sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite (CID 20837891) is sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite.
What is the SMILES notation for sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite?
The canonical SMILES for sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite is Nc1ccc(/N=N/c2ccccc2)c2ccccc12.O=S([O-])[O-].[Na+].
What is the InChIKey of sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite?
The InChIKey is WHNKXIVKNVARCE-BUFQOAPZSA-L. The full InChI is InChI=1S/C16H13N3.Na.H2O3S/c17-15-10-11-16(14-9-5-4-8-13(14)15)19-18-12-6-2-1-3-7-12;;1-4(2)3/h1-11H,17H2;;(H2,1,2,3)/q;+1;/p-2/b19-18+;;.
What are the key properties of sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite?
sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite has a molecular weight of 350.36 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-phenyldiazenylnaphthalen-1-amine;sulfite is sourced from PubChem (CID 20837891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).