C24H41ClN2O4 — CID 20839432
decyl-(2-hydroxyethyl)-[[4-methoxy-3-[(E)-2-nitroprop-1-enyl]phenyl]methyl]-methylazanium chloride (PubChem CID 20839432) has the molecular formula C24H41ClN2O4 and a molecular weight of 457.06 g/mol. Its IUPAC name is decyl-(2-hydroxyethyl)-[[4-methoxy-3-[(E)-2-nitroprop-1-enyl]phenyl]methyl]-methylazanium chloride.
| Compound Name | decyl-(2-hydroxyethyl)-[[4-methoxy-3-[(E)-2-nitroprop-1-enyl]phenyl]methyl]-methylazanium chloride |
|---|---|
| PubChem CID | 20839432 |
| Molecular Formula | C24H41ClN2O4 |
| Molecular Weight | 457.06 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | decyl-(2-hydroxyethyl)-[[4-methoxy-3-[(E)-2-nitroprop-1-enyl]phenyl]methyl]-methylazanium chloride |
| SMILES | CCCCCCCCCC[N+](C)(CCO)Cc1ccc(OC)c(/C=C(\C)[N+](=O)[O-])c1.[Cl-] |
| InChI | InChI=1S/C24H41N2O4.ClH/c1-5-6-7-8-9-10-11-12-15-26(3,16-17-27)20-22-13-14-24(30-4)23(19-22)18-21(2)25(28)29;/h13-14,18-19,27H,5-12,15-17,20H2,1-4H3;1H/q+1;/p-1/b21-18+; |
| InChIKey | QFNMPTGUZOZPNT-GOSREXKOSA-M |
| XLogP | 2.42 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.06 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|