C21H30N6O4 — CID 20840063
(Z)-but-2-enedioic acid;4-N-(2-phenylethyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 20840063) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-N-(2-phenylethyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | (Z)-but-2-enedioic acid;4-N-(2-phenylethyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20840063 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-N-(2-phenylethyl)-2-N,2-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCN(CCC)c1nc(N)nc(NCCc2ccccc2)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H26N6.C4H4O4/c1-3-12-23(13-4-2)17-21-15(18)20-16(22-17)19-11-10-14-8-6-5-7-9-14;5-3(6)1-2-4(7)8/h5-9H,3-4,10-13H2,1-2H3,(H3,18,19,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DDEMVJXZNIONQR-BTJKTKAUSA-N |
| XLogP | 2.45 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|