C25H32N2O4 — CID 20840153
1-[(2-benzylphenyl)methyl]-4-propan-2-ylpiperazine;(Z)-but-2-enedioic acid (PubChem CID 20840153) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[(2-benzylphenyl)methyl]-4-propan-2-ylpiperazine;(Z)-but-2-enedioic acid.
| Compound Name | 1-[(2-benzylphenyl)methyl]-4-propan-2-ylpiperazine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 20840153 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-[(2-benzylphenyl)methyl]-4-propan-2-ylpiperazine;(Z)-but-2-enedioic acid |
| SMILES | CC(C)N1CCN(Cc2ccccc2Cc2ccccc2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H28N2.C4H4O4/c1-18(2)23-14-12-22(13-15-23)17-21-11-7-6-10-20(21)16-19-8-4-3-5-9-19;5-3(6)1-2-4(7)8/h3-11,18H,12-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | HSJRDQICAHGPFF-BTJKTKAUSA-N |
| XLogP | 3.52 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|