C25H31N3O5 — CID 20840161
3-[4-[(2-benzylphenyl)methyl]piperazin-1-yl]propanamide;(Z)-but-2-enedioic acid (PubChem CID 20840161) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[4-[(2-benzylphenyl)methyl]piperazin-1-yl]propanamide;(Z)-but-2-enedioic acid.
| Compound Name | 3-[4-[(2-benzylphenyl)methyl]piperazin-1-yl]propanamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 20840161 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-[4-[(2-benzylphenyl)methyl]piperazin-1-yl]propanamide;(Z)-but-2-enedioic acid |
| SMILES | NC(=O)CCN1CCN(Cc2ccccc2Cc2ccccc2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H27N3O.C4H4O4/c22-21(25)10-11-23-12-14-24(15-13-23)17-20-9-5-4-8-19(20)16-18-6-2-1-3-7-18;5-3(6)1-2-4(7)8/h1-9H,10-17H2,(H2,22,25);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WCWQOMVPVNQPHY-BTJKTKAUSA-N |
| XLogP | 1.98 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|