C29H34N2O8 — CID 20840156
1-[(2-benzylphenyl)methyl]-4-prop-2-enylpiperazine;bis((Z)-but-2-enedioic acid) (PubChem CID 20840156) has the molecular formula C29H34N2O8 and a molecular weight of 538.60 g/mol. Its IUPAC name is 1-[(2-benzylphenyl)methyl]-4-prop-2-enylpiperazine;bis((Z)-but-2-enedioic acid).
| Compound Name | 1-[(2-benzylphenyl)methyl]-4-prop-2-enylpiperazine;bis((Z)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 20840156 |
| Molecular Formula | C29H34N2O8 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 1-[(2-benzylphenyl)methyl]-4-prop-2-enylpiperazine;bis((Z)-but-2-enedioic acid) |
| SMILES | C=CCN1CCN(Cc2ccccc2Cc2ccccc2)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H26N2.2C4H4O4/c1-2-12-22-13-15-23(16-14-22)18-21-11-7-6-10-20(21)17-19-8-4-3-5-9-19;2*5-3(6)1-2-4(7)8/h2-11H,1,12-18H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | SJUNHRMYBWNWJH-SPIKMXEPSA-N |
| XLogP | 3.00 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|