C19H29N3O4 — CID 20840844
(E)-but-2-enedioic acid;N-cyclohexyl-1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-amine (PubChem CID 20840844) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-cyclohexyl-1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-amine.
| Compound Name | (E)-but-2-enedioic acid;N-cyclohexyl-1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-amine |
|---|---|
| PubChem CID | 20840844 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (E)-but-2-enedioic acid;N-cyclohexyl-1-ethyl-4,5,6,7-tetrahydrobenzimidazol-5-amine |
| SMILES | CCn1cnc2c1CCC(NC1CCCCC1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H25N3.C4H4O4/c1-2-18-11-16-14-10-13(8-9-15(14)18)17-12-6-4-3-5-7-12;5-3(6)1-2-4(7)8/h11-13,17H,2-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HXLMVNKQXNXNOF-WLHGVMLRSA-N |
| XLogP | 2.39 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|