C11H15N5O4 — CID 20843556
2-[[(3Z)-3-(carbamoylhydrazinylidene)butanoyl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 20843556) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[[(3Z)-3-(carbamoylhydrazinylidene)butanoyl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[[(3Z)-3-(carbamoylhydrazinylidene)butanoyl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 20843556 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[[(3Z)-3-(carbamoylhydrazinylidene)butanoyl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | C/C(CC(=O)Nc1ccccc1[NH+]([O-])O)=N/NC(N)=O |
| InChI | InChI=1S/C11H15N5O4/c1-7(14-15-11(12)18)6-10(17)13-8-4-2-3-5-9(8)16(19)20/h2-5,16,19H,6H2,1H3,(H,13,17)(H3,12,15,18)/b14-7- |
| InChIKey | QPPDBAQKFADPAS-AUWJEWJLSA-N |
| XLogP | -0.54 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|