C24H37N5O4 — CID 20844440
ethyl N-[(Z)-1-[(3S,8R,9S,10R,13S,14S,16R,17R)-17-azido-3,16-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate (PubChem CID 20844440) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is ethyl N-[(Z)-1-[(3S,8R,9S,10R,13S,14S,16R,17R)-17-azido-3,16-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate.
| Compound Name | ethyl N-[(Z)-1-[(3S,8R,9S,10R,13S,14S,16R,17R)-17-azido-3,16-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 20844440 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | ethyl N-[(Z)-1-[(3S,8R,9S,10R,13S,14S,16R,17R)-17-azido-3,16-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C(/C)[C@@]1(N=[N+]=[N-])[C@H](O)C[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H37N5O4/c1-5-33-21(32)27-26-14(2)24(28-29-25)20(31)13-19-17-7-6-15-12-16(30)8-10-22(15,3)18(17)9-11-23(19,24)4/h6,16-20,30-31H,5,7-13H2,1-4H3,(H,27,32)/b26-14-/t16-,17+,18-,19-,20+,22-,23-,24+/m0/s1 |
| InChIKey | STCBBMFHAJQVTA-MQKDQLJMSA-N |
| XLogP | 4.45 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|