C24H38N6O3 — CID 23267935
ethyl N-[1-[(3S,10R,13S,16R,17S)-16-amino-17-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate (PubChem CID 23267935) has the molecular formula C24H38N6O3 and a molecular weight of 458.61 g/mol. Its IUPAC name is ethyl N-[1-[(3S,10R,13S,16R,17S)-16-amino-17-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate.
| Compound Name | ethyl N-[1-[(3S,10R,13S,16R,17S)-16-amino-17-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 23267935 |
| Molecular Formula | C24H38N6O3 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | ethyl N-[1-[(3S,10R,13S,16R,17S)-16-amino-17-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino]carbamate |
| SMILES | CCOC(=O)NN=C(C)[C@@]1(N=[N+]=[N-])[C@H](N)CC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H38N6O3/c1-5-33-21(32)28-27-14(2)24(29-30-26)20(25)13-19-17-7-6-15-12-16(31)8-10-22(15,3)18(17)9-11-23(19,24)4/h6,16-20,31H,5,7-13,25H2,1-4H3,(H,28,32)/t16-,17?,18?,19?,20+,22-,23-,24+/m0/s1 |
| InChIKey | CBCYMRCWFXFNHJ-KNYFFHCESA-N |
| XLogP | 4.42 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|