C14H27NO — CID 20847519
(5E,7E)-1-aminotetradeca-5,7-dien-3-ol (PubChem CID 20847519) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (5E,7E)-1-aminotetradeca-5,7-dien-3-ol.
| Compound Name | (5E,7E)-1-aminotetradeca-5,7-dien-3-ol |
|---|---|
| PubChem CID | 20847519 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (5E,7E)-1-aminotetradeca-5,7-dien-3-ol |
| SMILES | CCCCCC/C=C/C=C/CC(O)CCN |
| InChI | InChI=1S/C14H27NO/c1-2-3-4-5-6-7-8-9-10-11-14(16)12-13-15/h7-10,14,16H,2-6,11-13,15H2,1H3/b8-7+,10-9+ |
| InChIKey | KWHZMDKDJRAKRU-XBLVEGMJSA-N |
| XLogP | 3.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|