C25H34O7 — CID 20847576
methyl (2E,4E,6E,8E,10E)-2,3-diacetyloxy-12-oxoicosa-2,4,6,8,10-pentaenoate (PubChem CID 20847576) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E,10E)-2,3-diacetyloxy-12-oxoicosa-2,4,6,8,10-pentaenoate.
| Compound Name | methyl (2E,4E,6E,8E,10E)-2,3-diacetyloxy-12-oxoicosa-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 20847576 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl (2E,4E,6E,8E,10E)-2,3-diacetyloxy-12-oxoicosa-2,4,6,8,10-pentaenoate |
| SMILES | CCCCCCCCC(=O)/C=C/C=C/C=C/C=C/C(OC(C)=O)=C(\OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C25H34O7/c1-5-6-7-8-11-14-17-22(28)18-15-12-9-10-13-16-19-23(31-20(2)26)24(25(29)30-4)32-21(3)27/h9-10,12-13,15-16,18-19H,5-8,11,14,17H2,1-4H3/b12-9+,13-10+,18-15+,19-16+,24-23+ |
| InChIKey | YPAOMPWSKSVTDL-PRFVDISXSA-N |
| XLogP | 5.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|