C19H16N2O2S — CID 20849777
[2-imino-2-(2-phenyl-1,3-thiazol-4-yl)ethyl] 4-methylbenzoate (PubChem CID 20849777) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is [2-imino-2-(2-phenyl-1,3-thiazol-4-yl)ethyl] 4-methylbenzoate.
| Compound Name | [2-imino-2-(2-phenyl-1,3-thiazol-4-yl)ethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20849777 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [2-imino-2-(2-phenyl-1,3-thiazol-4-yl)ethyl] 4-methylbenzoate |
| SMILES | [H]/N=C(/COC(=O)c1ccc(C)cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H16N2O2S/c1-13-7-9-15(10-8-13)19(22)23-11-16(20)17-12-24-18(21-17)14-5-3-2-4-6-14/h2-10,12,20H,11H2,1H3/b20-16- |
| InChIKey | YRKQIYHFJXQCPK-SILNSSARSA-N |
| XLogP | 4.34 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|