C16H13N3O3S — CID 20849639
[2-imino-2-[2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]ethyl] benzoate (PubChem CID 20849639) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is [2-imino-2-[2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]ethyl] benzoate.
| Compound Name | [2-imino-2-[2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 20849639 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | [2-imino-2-[2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl]ethyl] benzoate |
| SMILES | [H]/N=C(/COC(=O)c1ccccc1)c1csc(-c2cc(C)on2)n1 |
| InChI | InChI=1S/C16H13N3O3S/c1-10-7-13(19-22-10)15-18-14(9-23-15)12(17)8-21-16(20)11-5-3-2-4-6-11/h2-7,9,17H,8H2,1H3/b17-12- |
| InChIKey | QLACBPLAIGYIQB-ATVHPVEESA-N |
| XLogP | 3.33 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|