C11H12N4O — CID 20867039
2-pyrrolidin-1-yl-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 20867039) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-pyrrolidin-1-yl-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 20867039 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-pyrrolidin-1-yl-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=c1[nH]ccc2nc(N3CCCC3)ncc12 |
| InChI | InChI=1S/C11H12N4O/c16-10-8-7-13-11(15-5-1-2-6-15)14-9(8)3-4-12-10/h3-4,7H,1-2,5-6H2,(H,12,16) |
| InChIKey | VFDQBLHNJCPCCJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |