C19H20N4O2 — CID 30467389
6-(3-methoxyphenyl)-2-piperidin-1-ylpyrido[4,3-d]pyrimidin-5-one (PubChem CID 30467389) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-2-piperidin-1-ylpyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(3-methoxyphenyl)-2-piperidin-1-ylpyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 30467389 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 6-(3-methoxyphenyl)-2-piperidin-1-ylpyrido[4,3-d]pyrimidin-5-one |
| SMILES | COc1cccc(-n2ccc3nc(N4CCCCC4)ncc3c2=O)c1 |
| InChI | InChI=1S/C19H20N4O2/c1-25-15-7-5-6-14(12-15)23-11-8-17-16(18(23)24)13-20-19(21-17)22-9-3-2-4-10-22/h5-8,11-13H,2-4,9-10H2,1H3 |
| InChIKey | WAGJEUPUEAAOFJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |