About 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one
6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one (PubChem CID 44616049) has the molecular formula C21H25N5O2
and a molecular weight of 379.46 g/mol. Its IUPAC name is 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 44616049 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one |
| SMILES | COCCCn1ccc2nc(N3CCN(c4ccccc4)CC3)ncc2c1=O |
| InChI | InChI=1S/C21H25N5O2/c1-28-15-5-9-25-10-8-19-18(20(25)27)16-22-21(23-19)26-13-11-24(12-14-26)17-6-3-2-4-7-17/h2-4,6-8,10,16H,5,9,11-15H2,1H3 |
| InChIKey | LLULIJVUKUDKDV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one (CID 44616049) is 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one is COCCCn1ccc2nc(N3CCN(c4ccccc4)CC3)ncc2c1=O.
What is the InChIKey of 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one?
The InChIKey is LLULIJVUKUDKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O2/c1-28-15-5-9-25-10-8-19-18(20(25)27)16-22-21(23-19)26-13-11-24(12-14-26)17-6-3-2-4-7-17/h2-4,6-8,10,16H,5,9,11-15H2,1H3.
What are the key properties of 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one?
6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one has a molecular weight of 379.46 g/mol, XLogP of 2.15, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methoxypropyl)-2-(4-phenylpiperazin-1-yl)pyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 44616049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).