C17H16N4OS — CID 46397650
2-pyrrolidin-1-yl-6-(2-sulfanylphenyl)pyrido[4,3-d]pyrimidin-5-one (PubChem CID 46397650) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-6-(2-sulfanylphenyl)pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-pyrrolidin-1-yl-6-(2-sulfanylphenyl)pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 46397650 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-pyrrolidin-1-yl-6-(2-sulfanylphenyl)pyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=c1c2cnc(N3CCCC3)nc2ccn1-c1ccccc1S |
| InChI | InChI=1S/C17H16N4OS/c22-16-12-11-18-17(20-8-3-4-9-20)19-13(12)7-10-21(16)14-5-1-2-6-15(14)23/h1-2,5-7,10-11,23H,3-4,8-9H2 |
| InChIKey | KMXAIRFDABCTQP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|