C25H22F3N5 — CID 20875744
1-(pyridin-4-ylmethyl)-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phthalazine (PubChem CID 20875744) has the molecular formula C25H22F3N5 and a molecular weight of 449.48 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phthalazine.
| Compound Name | 1-(pyridin-4-ylmethyl)-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phthalazine |
|---|---|
| PubChem CID | 20875744 |
| Molecular Formula | C25H22F3N5 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phthalazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(c3nnc(Cc4ccncc4)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C25H22F3N5/c26-25(27,28)19-4-3-5-20(17-19)32-12-14-33(15-13-32)24-22-7-2-1-6-21(22)23(30-31-24)16-18-8-10-29-11-9-18/h1-11,17H,12-16H2 |
| InChIKey | PBGGTBCALLLFEL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |