C23H20F3N5 — CID 135268190
N'-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine (PubChem CID 135268190) has the molecular formula C23H20F3N5 and a molecular weight of 423.44 g/mol. Its IUPAC name is N'-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 135268190 |
| Molecular Formula | C23H20F3N5 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N'-[4-(pyridin-4-ylmethyl)phthalazin-1-yl]-N-[3-(trifluoromethyl)phenyl]ethane-1,2-diamine |
| SMILES | FC(F)(F)c1cccc(NCCNc2nnc(Cc3ccncc3)c3ccccc23)c1 |
| InChI | InChI=1S/C23H20F3N5/c24-23(25,26)17-4-3-5-18(15-17)28-12-13-29-22-20-7-2-1-6-19(20)21(30-31-22)14-16-8-10-27-11-9-16/h1-11,15,28H,12-14H2,(H,29,31) |
| InChIKey | XQZIRLKIPBRNIV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|