C29H29N3O2S — CID 20887938
1-(5-benzyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea (PubChem CID 20887938) has the molecular formula C29H29N3O2S and a molecular weight of 483.64 g/mol. Its IUPAC name is 1-(5-benzyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea.
| Compound Name | 1-(5-benzyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 20887938 |
| Molecular Formula | C29H29N3O2S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-(5-benzyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCCCC1)Nc1ccc2c(c1)N(Cc1ccccc1)C(=O)c1ccccc1S2 |
| InChI | InChI=1S/C29H29N3O2S/c33-28-24-13-7-8-14-26(24)35-27-16-15-23(19-25(27)32(28)20-22-11-5-2-6-12-22)31-29(34)30-18-17-21-9-3-1-4-10-21/h2,5-9,11-16,19H,1,3-4,10,17-18,20H2,(H2,30,31,34) |
| InChIKey | DBJJCIUFKDEUAU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|