C23H21N3O2S — CID 4050280
1-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-(2-phenylethyl)urea (PubChem CID 4050280) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-(2-phenylethyl)urea.
| Compound Name | 1-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 4050280 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)-3-(2-phenylethyl)urea |
| SMILES | CN1C(=O)c2ccccc2Sc2ccc(NC(=O)NCCc3ccccc3)cc21 |
| InChI | InChI=1S/C23H21N3O2S/c1-26-19-15-17(25-23(28)24-14-13-16-7-3-2-4-8-16)11-12-21(19)29-20-10-6-5-9-18(20)22(26)27/h2-12,15H,13-14H2,1H3,(H2,24,25,28) |
| InChIKey | MVEXHONHGIZRPJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |