C27H23F6N3O2S — CID 73438606
1-[4-[2,5-bis(trifluoromethyl)phenyl]butyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea (PubChem CID 73438606) has the molecular formula C27H23F6N3O2S and a molecular weight of 567.56 g/mol. Its IUPAC name is 1-[4-[2,5-bis(trifluoromethyl)phenyl]butyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea.
| Compound Name | 1-[4-[2,5-bis(trifluoromethyl)phenyl]butyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea |
|---|---|
| PubChem CID | 73438606 |
| Molecular Formula | C27H23F6N3O2S |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 1-[4-[2,5-bis(trifluoromethyl)phenyl]butyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea |
| SMILES | CN1C(=O)c2ccccc2Sc2ccc(NC(=O)NCCCCc3cc(C(F)(F)F)ccc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C27H23F6N3O2S/c1-36-21-15-18(10-12-23(21)39-22-8-3-2-7-19(22)24(36)37)35-25(38)34-13-5-4-6-16-14-17(26(28,29)30)9-11-20(16)27(31,32)33/h2-3,7-12,14-15H,4-6,13H2,1H3,(H2,34,35,38) |
| InChIKey | XADJGFOLHXYZEJ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|