C24H21F2N3O2S — CID 71604381
1-[3-(3,5-difluorophenyl)propyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea (PubChem CID 71604381) has the molecular formula C24H21F2N3O2S and a molecular weight of 453.51 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)propyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea.
| Compound Name | 1-[3-(3,5-difluorophenyl)propyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea |
|---|---|
| PubChem CID | 71604381 |
| Molecular Formula | C24H21F2N3O2S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)propyl]-3-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-3-yl)urea |
| SMILES | CN1C(=O)c2ccccc2Sc2ccc(NC(=O)NCCCc3cc(F)cc(F)c3)cc21 |
| InChI | InChI=1S/C24H21F2N3O2S/c1-29-20-14-18(8-9-22(20)32-21-7-3-2-6-19(21)23(29)30)28-24(31)27-10-4-5-15-11-16(25)13-17(26)12-15/h2-3,6-9,11-14H,4-5,10H2,1H3,(H2,27,28,31) |
| InChIKey | FNNCVODNNFZLFQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|